About 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine
2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine (PubChem CID 175018575) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine |
| PubChem CID | 175018575 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine |
| SMILES | CCN(C)C.c1cc2ncc1-2 |
| InChI | InChI=1S/C5H3N.C4H11N/c1-2-5-4(1)3-6-5;1-4-5(2)3/h1-3H;4H2,1-3H3 |
| InChIKey | HKUJNVDXXVZTSR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine?
The IUPAC name of 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine (CID 175018575) is 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine.
What is the SMILES notation for 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine?
The canonical SMILES for 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine is CCN(C)C.c1cc2ncc1-2.
What is the InChIKey of 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine?
The InChIKey is HKUJNVDXXVZTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N.C4H11N/c1-2-5-4(1)3-6-5;1-4-5(2)3/h1-3H;4H2,1-3H3.
What are the key properties of 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine?
2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine has a molecular weight of 150.22 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.0]hexa-1,3,5-triene;N,N-dimethylethanamine is sourced from PubChem (CID 175018575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).