About (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid
(4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid (PubChem CID 175018807) has the molecular formula C16H10F3N3O4
and a molecular weight of 365.27 g/mol. Its IUPAC name is (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid |
| PubChem CID | 175018807 |
| Molecular Formula | C16H10F3N3O4 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid |
| SMILES | CC(=O)n1c2c(c3ccccc31)[C@](C(=O)O)(C(F)(F)F)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C16H10F3N3O4/c1-7(23)22-10-5-3-2-4-8(10)11-13(22)26-12(21)9(6-20)15(11,14(24)25)16(17,18)19/h2-5H,21H2,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | BCFYOYVYMRKSAT-OAHLLOKOSA-N |
| XLogP | 2.27 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid?
The IUPAC name of (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid (CID 175018807) is (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid.
What is the SMILES notation for (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid?
The canonical SMILES for (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid is CC(=O)n1c2c(c3ccccc31)[C@](C(=O)O)(C(F)(F)F)C(C#N)=C(N)O2.
What is the InChIKey of (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid?
The InChIKey is BCFYOYVYMRKSAT-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H10F3N3O4/c1-7(23)22-10-5-3-2-4-8(10)11-13(22)26-12(21)9(6-20)15(11,14(24)25)16(17,18)19/h2-5H,21H2,1H3,(H,24,25)/t15-/m1/s1.
What are the key properties of (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid?
(4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid has a molecular weight of 365.27 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-9-acetyl-2-amino-3-cyano-4-(trifluoromethyl)pyrano[2,3-b]indole-4-carboxylic acid is sourced from PubChem (CID 175018807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).