About bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate
bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate (PubChem CID 175019198) has the molecular formula C24H40O5
and a molecular weight of 408.58 g/mol. Its IUPAC name is bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate.
Molecular Properties
| Compound Name | bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate |
| PubChem CID | 175019198 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate |
| SMILES | CC(C)CCCCCOC(=O)C12C=CCCC1(C(=O)OCCCCCC(C)C)O2 |
| InChI | InChI=1S/C24H40O5/c1-19(2)13-7-5-11-17-27-21(25)23-15-9-10-16-24(23,29-23)22(26)28-18-12-6-8-14-20(3)4/h9,15,19-20H,5-8,10-14,16-18H2,1-4H3 |
| InChIKey | XOIAWDIHNGVBIU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate?
The IUPAC name of bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate (CID 175019198) is bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate.
What is the SMILES notation for bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate?
The canonical SMILES for bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate is CC(C)CCCCCOC(=O)C12C=CCCC1(C(=O)OCCCCCC(C)C)O2.
What is the InChIKey of bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate?
The InChIKey is XOIAWDIHNGVBIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40O5/c1-19(2)13-7-5-11-17-27-21(25)23-15-9-10-16-24(23,29-23)22(26)28-18-12-6-8-14-20(3)4/h9,15,19-20H,5-8,10-14,16-18H2,1-4H3.
What are the key properties of bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate?
bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate has a molecular weight of 408.58 g/mol, XLogP of 5.36, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-methylheptyl) 7-oxabicyclo[4.1.0]hept-2-ene-1,6-dicarboxylate is sourced from PubChem (CID 175019198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).