C28H31ClN6O2S — CID 175019435
N-[(4-chlorophenyl)methylideneamino]-1-ethyl-5-[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]indole-3-carboxamide (PubChem CID 175019435) has the molecular formula C28H31ClN6O2S and a molecular weight of 551.12 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-1-ethyl-5-[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]indole-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-1-ethyl-5-[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 175019435 |
| Molecular Formula | C28H31ClN6O2S |
| Molecular Weight | 551.12 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-1-ethyl-5-[4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]indole-3-carboxamide |
| SMILES | CCn1cc(C(=O)NN=Cc2ccc(Cl)cc2)c2cc(-c3nc(CN4CCN(CCO)CC4)cs3)ccc21 |
| InChI | InChI=1S/C28H31ClN6O2S/c1-2-35-18-25(27(37)32-30-16-20-3-6-22(29)7-4-20)24-15-21(5-8-26(24)35)28-31-23(19-38-28)17-34-11-9-33(10-12-34)13-14-36/h3-8,15-16,18-19,36H,2,9-14,17H2,1H3,(H,32,37) |
| InChIKey | XQISFBMZGPMYEG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|