About tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane
tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane (PubChem CID 175019477) has the molecular formula C19H29F2NO2Si
and a molecular weight of 369.53 g/mol. Its IUPAC name is tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane |
| PubChem CID | 175019477 |
| Molecular Formula | C19H29F2NO2Si |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C/Cc1cc(F)c(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H29F2NO2Si/c1-19(2,3)25(4,5)24-10-6-7-15-13-16(20)18(17(21)14-15)22-8-11-23-12-9-22/h6,10,13-14H,7-9,11-12H2,1-5H3/b10-6+ |
| InChIKey | NFJRYEBIVILMOH-UXBLZVDNSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane (CID 175019477) is tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane is CC(C)(C)[Si](C)(C)O/C=C/Cc1cc(F)c(N2CCOCC2)c(F)c1.
What is the InChIKey of tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane?
The InChIKey is NFJRYEBIVILMOH-UXBLZVDNSA-N. The full InChI is InChI=1S/C19H29F2NO2Si/c1-19(2,3)25(4,5)24-10-6-7-15-13-16(20)18(17(21)14-15)22-8-11-23-12-9-22/h6,10,13-14H,7-9,11-12H2,1-5H3/b10-6+.
What are the key properties of tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane?
tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane has a molecular weight of 369.53 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)prop-1-enoxy]-dimethylsilane is sourced from PubChem (CID 175019477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).