C29H51NO — CID 175019555
(3S,8S,9S,10R,13R,14S,17R)-17-(9-amino-6-methylnonan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 175019555) has the molecular formula C29H51NO and a molecular weight of 429.73 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-(9-amino-6-methylnonan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-(9-amino-6-methylnonan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 175019555 |
| Molecular Formula | C29H51NO |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 429.40 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-(9-amino-6-methylnonan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(CCCN)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H51NO/c1-20(8-6-18-30)7-5-9-21(2)25-12-13-26-24-11-10-22-19-23(31)14-16-28(22,3)27(24)15-17-29(25,26)4/h10,20-21,23-27,31H,5-9,11-19,30H2,1-4H3/t20?,21?,23-,24-,25+,26-,27-,28-,29+/m0/s1 |
| InChIKey | ZLGJBAYMEDCNJM-UWKHYISVSA-N |
| XLogP | 7.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|