C6H9N3OS2 — CID 175020205
6-(2-hydroxypropyl)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 175020205) has the molecular formula C6H9N3OS2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-(2-hydroxypropyl)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(2-hydroxypropyl)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 175020205 |
| Molecular Formula | C6H9N3OS2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 6-(2-hydroxypropyl)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CC(O)Cc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C6H9N3OS2/c1-3(10)2-4-7-5(11)9-6(12)8-4/h3,10H,2H2,1H3,(H2,7,8,9,11,12) |
| InChIKey | SQMXKHLVERAYQO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|