C9H18Si3 — CID 175020258
1,1,2-tris(ethenyl)-2,3,3-trimethyltrisilirane (PubChem CID 175020258) has the molecular formula C9H18Si3 and a molecular weight of 210.50 g/mol. Its IUPAC name is 1,1,2-tris(ethenyl)-2,3,3-trimethyltrisilirane.
| Compound Name | 1,1,2-tris(ethenyl)-2,3,3-trimethyltrisilirane |
|---|---|
| PubChem CID | 175020258 |
| Molecular Formula | C9H18Si3 |
| Molecular Weight | 210.50 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1,1,2-tris(ethenyl)-2,3,3-trimethyltrisilirane |
| SMILES | C=C[Si]1(C)[Si](C)(C)[Si]1(C=C)C=C |
| InChI | InChI=1S/C9H18Si3/c1-7-11(6)10(4,5)12(11,8-2)9-3/h7-9H,1-3H2,4-6H3 |
| InChIKey | KBXLIRPHRGIPSM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|