C15H30N2 — CID 175020542
1,3,4-tributyl-2H-imidazole (PubChem CID 175020542) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 1,3,4-tributyl-2H-imidazole.
| Compound Name | 1,3,4-tributyl-2H-imidazole |
|---|---|
| PubChem CID | 175020542 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 1,3,4-tributyl-2H-imidazole |
| SMILES | CCCCC1=CN(CCCC)CN1CCCC |
| InChI | InChI=1S/C15H30N2/c1-4-7-10-15-13-16(11-8-5-2)14-17(15)12-9-6-3/h13H,4-12,14H2,1-3H3 |
| InChIKey | RWTLXVOSAQRMIY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |