C19H23N3O5 — CID 175020711
3-pyridin-3-ylbutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate (PubChem CID 175020711) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-pyridin-3-ylbutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate.
| Compound Name | 3-pyridin-3-ylbutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 175020711 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-pyridin-3-ylbutan-2-yl 2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
| SMILES | COc1ccnc(C(=O)NC(C)C(=O)OC(C)C(C)c2cccnc2)c1O |
| InChI | InChI=1S/C19H23N3O5/c1-11(14-6-5-8-20-10-14)13(3)27-19(25)12(2)22-18(24)16-17(23)15(26-4)7-9-21-16/h5-13,23H,1-4H3,(H,22,24) |
| InChIKey | HBMBDZLWAIYXMN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |