C11H12OS — CID 175021470
3-(thiophen-2-ylmethyl)hexa-4,5-dien-2-one (PubChem CID 175021470) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethyl)hexa-4,5-dien-2-one.
| Compound Name | 3-(thiophen-2-ylmethyl)hexa-4,5-dien-2-one |
|---|---|
| PubChem CID | 175021470 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-(thiophen-2-ylmethyl)hexa-4,5-dien-2-one |
| SMILES | C=C=CC(Cc1cccs1)C(C)=O |
| InChI | InChI=1S/C11H12OS/c1-3-5-10(9(2)12)8-11-6-4-7-13-11/h4-7,10H,1,8H2,2H3 |
| InChIKey | JWQBPEDFSXJFDJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |