About di(propan-2-yl)silane;hydron
di(propan-2-yl)silane;hydron (PubChem CID 175022063) has the molecular formula C6H18Si+2
and a molecular weight of 118.30 g/mol. Its IUPAC name is di(propan-2-yl)silane;hydron.
Molecular Properties
| Compound Name | di(propan-2-yl)silane;hydron |
| PubChem CID | 175022063 |
| Molecular Formula | C6H18Si+2 |
| Molecular Weight | 118.30 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | di(propan-2-yl)silane;hydron |
| SMILES | CC(C)[SiH2]C(C)C.[H+].[H+] |
| InChI | InChI=1S/C6H16Si/c1-5(2)7-6(3)4/h5-6H,7H2,1-4H3/p+2 |
| InChIKey | DEHCLLRUWOGPJR-UHFFFAOYSA-P |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yl)silane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)silane;hydron?
The IUPAC name of di(propan-2-yl)silane;hydron (CID 175022063) is di(propan-2-yl)silane;hydron.
What is the SMILES notation for di(propan-2-yl)silane;hydron?
The canonical SMILES for di(propan-2-yl)silane;hydron is CC(C)[SiH2]C(C)C.[H+].[H+].
What is the InChIKey of di(propan-2-yl)silane;hydron?
The InChIKey is DEHCLLRUWOGPJR-UHFFFAOYSA-P. The full InChI is InChI=1S/C6H16Si/c1-5(2)7-6(3)4/h5-6H,7H2,1-4H3/p+2.
What are the key properties of di(propan-2-yl)silane;hydron?
di(propan-2-yl)silane;hydron has a molecular weight of 118.30 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)silane;hydron is sourced from PubChem (CID 175022063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).