About sodium;amino N-ethylidenecarbamodithioate;hydride
sodium;amino N-ethylidenecarbamodithioate;hydride (PubChem CID 175022401) has the molecular formula C3H7N2NaS2
and a molecular weight of 158.23 g/mol. Its IUPAC name is sodium;amino N-ethylidenecarbamodithioate;hydride.
Molecular Properties
| Compound Name | sodium;amino N-ethylidenecarbamodithioate;hydride |
| PubChem CID | 175022401 |
| Molecular Formula | C3H7N2NaS2 |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | sodium;amino N-ethylidenecarbamodithioate;hydride |
| SMILES | CC=NC(=S)SN.[H-].[Na+] |
| InChI | InChI=1S/C3H6N2S2.Na.H/c1-2-5-3(6)7-4;;/h2H,4H2,1H3;;/q;+1;-1 |
| InChIKey | UWAWEMHYERGXMB-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;amino N-ethylidenecarbamodithioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;amino N-ethylidenecarbamodithioate;hydride?
The IUPAC name of sodium;amino N-ethylidenecarbamodithioate;hydride (CID 175022401) is sodium;amino N-ethylidenecarbamodithioate;hydride.
What is the SMILES notation for sodium;amino N-ethylidenecarbamodithioate;hydride?
The canonical SMILES for sodium;amino N-ethylidenecarbamodithioate;hydride is CC=NC(=S)SN.[H-].[Na+].
What is the InChIKey of sodium;amino N-ethylidenecarbamodithioate;hydride?
The InChIKey is UWAWEMHYERGXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S2.Na.H/c1-2-5-3(6)7-4;;/h2H,4H2,1H3;;/q;+1;-1.
What are the key properties of sodium;amino N-ethylidenecarbamodithioate;hydride?
sodium;amino N-ethylidenecarbamodithioate;hydride has a molecular weight of 158.23 g/mol, XLogP of -1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;amino N-ethylidenecarbamodithioate;hydride is sourced from PubChem (CID 175022401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).