About 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum
5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum (PubChem CID 175022607) has the molecular formula C21H21N3Pt
and a molecular weight of 510.50 g/mol. Its IUPAC name is 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum.
Molecular Properties
| Compound Name | 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum |
| PubChem CID | 175022607 |
| Molecular Formula | C21H21N3Pt |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum |
| SMILES | CCN1c2cc(N)ccc2-c2ccc(N)cc2C1c1ccccc1.[Pt] |
| InChI | InChI=1S/C21H21N3.Pt/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,21H,2,22-23H2,1H3; |
| InChIKey | BKAIXWIRKGBDNN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum?
The IUPAC name of 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum (CID 175022607) is 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum.
What is the SMILES notation for 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum?
The canonical SMILES for 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum is CCN1c2cc(N)ccc2-c2ccc(N)cc2C1c1ccccc1.[Pt].
What is the InChIKey of 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum?
The InChIKey is BKAIXWIRKGBDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3.Pt/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,21H,2,22-23H2,1H3;.
What are the key properties of 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum?
5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum has a molecular weight of 510.50 g/mol, XLogP of 4.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine;platinum is sourced from PubChem (CID 175022607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).