About indeno[5,4-f]isoquinolin-6-one
indeno[5,4-f]isoquinolin-6-one (PubChem CID 175022970) has the molecular formula C16H9NO
and a molecular weight of 231.25 g/mol. Its IUPAC name is indeno[5,4-f]isoquinolin-6-one.
Molecular Properties
| Compound Name | indeno[5,4-f]isoquinolin-6-one |
| PubChem CID | 175022970 |
| Molecular Formula | C16H9NO |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | indeno[5,4-f]isoquinolin-6-one |
| SMILES | O=C1N=CC=c2c1ccc1c3c(ccc21)C=CC=3 |
| InChI | InChI=1S/C16H9NO/c18-16-15-7-6-12-11-3-1-2-10(11)4-5-13(12)14(15)8-9-17-16/h1-9H |
| InChIKey | UTYQGXYYMXSZKM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indeno[5,4-f]isoquinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[5,4-f]isoquinolin-6-one?
The IUPAC name of indeno[5,4-f]isoquinolin-6-one (CID 175022970) is indeno[5,4-f]isoquinolin-6-one.
What is the SMILES notation for indeno[5,4-f]isoquinolin-6-one?
The canonical SMILES for indeno[5,4-f]isoquinolin-6-one is O=C1N=CC=c2c1ccc1c3c(ccc21)C=CC=3.
What is the InChIKey of indeno[5,4-f]isoquinolin-6-one?
The InChIKey is UTYQGXYYMXSZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO/c18-16-15-7-6-12-11-3-1-2-10(11)4-5-13(12)14(15)8-9-17-16/h1-9H.
What are the key properties of indeno[5,4-f]isoquinolin-6-one?
indeno[5,4-f]isoquinolin-6-one has a molecular weight of 231.25 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[5,4-f]isoquinolin-6-one is sourced from PubChem (CID 175022970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).