About cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane
cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane (PubChem CID 175023032) has the molecular formula C30H45O2P
and a molecular weight of 468.66 g/mol. Its IUPAC name is cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane.
Molecular Properties
| Compound Name | cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane |
| PubChem CID | 175023032 |
| Molecular Formula | C30H45O2P |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane |
| SMILES | C1CCC(C2CCCCC2)CC1.CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P |
| InChI | InChI=1S/C18H23O2P.C12H22/c1-12(2)19-15-9-7-10-16(20-13(3)4)18(15)14-8-5-6-11-17(14)21;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5-13H,21H2,1-4H3;11-12H,1-10H2 |
| InChIKey | MNQBNNQNDDMNPV-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane?
The IUPAC name of cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane (CID 175023032) is cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane.
What is the SMILES notation for cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane?
The canonical SMILES for cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane is C1CCC(C2CCCCC2)CC1.CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P.
What is the InChIKey of cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane?
The InChIKey is MNQBNNQNDDMNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23O2P.C12H22/c1-12(2)19-15-9-7-10-16(20-13(3)4)18(15)14-8-5-6-11-17(14)21;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5-13H,21H2,1-4H3;11-12H,1-10H2.
What are the key properties of cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane?
cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane has a molecular weight of 468.66 g/mol, XLogP of 8.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcyclohexane;[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane is sourced from PubChem (CID 175023032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).