About 1-pyrrol-1-ylpyrrole;thiophene
1-pyrrol-1-ylpyrrole;thiophene (PubChem CID 175023544) has the molecular formula C12H12N2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-pyrrol-1-ylpyrrole;thiophene.
Molecular Properties
| Compound Name | 1-pyrrol-1-ylpyrrole;thiophene |
| PubChem CID | 175023544 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-pyrrol-1-ylpyrrole;thiophene |
| SMILES | c1ccn(-n2cccc2)c1.c1ccsc1 |
| InChI | InChI=1S/C8H8N2.C4H4S/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1/h1-8H;1-4H |
| InChIKey | WDJISJZEKYBHJZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyrrol-1-ylpyrrole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrol-1-ylpyrrole;thiophene?
The IUPAC name of 1-pyrrol-1-ylpyrrole;thiophene (CID 175023544) is 1-pyrrol-1-ylpyrrole;thiophene.
What is the SMILES notation for 1-pyrrol-1-ylpyrrole;thiophene?
The canonical SMILES for 1-pyrrol-1-ylpyrrole;thiophene is c1ccn(-n2cccc2)c1.c1ccsc1.
What is the InChIKey of 1-pyrrol-1-ylpyrrole;thiophene?
The InChIKey is WDJISJZEKYBHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H4S/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1/h1-8H;1-4H.
What are the key properties of 1-pyrrol-1-ylpyrrole;thiophene?
1-pyrrol-1-ylpyrrole;thiophene has a molecular weight of 216.31 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrol-1-ylpyrrole;thiophene is sourced from PubChem (CID 175023544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).