About [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate
[(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate (PubChem CID 175023863) has the molecular formula C14H22F2N2O5
and a molecular weight of 336.34 g/mol. Its IUPAC name is [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate.
Molecular Properties
| Compound Name | [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate |
| PubChem CID | 175023863 |
| Molecular Formula | C14H22F2N2O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate |
| SMILES | CCCC(=O)OC1[C@H](NC(=O)OC(C)(C)C)C(=O)NCC1(F)F |
| InChI | InChI=1S/C14H22F2N2O5/c1-5-6-8(19)22-10-9(11(20)17-7-14(10,15)16)18-12(21)23-13(2,3)4/h9-10H,5-7H2,1-4H3,(H,17,20)(H,18,21)/t9-,10?/m0/s1 |
| InChIKey | UDKGEVOZQARJEH-RGURZIINSA-N |
| XLogP | 1.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate?
The IUPAC name of [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate (CID 175023863) is [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate.
What is the SMILES notation for [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate?
The canonical SMILES for [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate is CCCC(=O)OC1[C@H](NC(=O)OC(C)(C)C)C(=O)NCC1(F)F.
What is the InChIKey of [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate?
The InChIKey is UDKGEVOZQARJEH-RGURZIINSA-N. The full InChI is InChI=1S/C14H22F2N2O5/c1-5-6-8(19)22-10-9(11(20)17-7-14(10,15)16)18-12(21)23-13(2,3)4/h9-10H,5-7H2,1-4H3,(H,17,20)(H,18,21)/t9-,10?/m0/s1.
What are the key properties of [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate?
[(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate has a molecular weight of 336.34 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5,5-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopiperidin-4-yl] butanoate is sourced from PubChem (CID 175023863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).