C22H16F6N4O3 — CID 175024289
(3R)-2-(2,4-difluorophenyl)-3-[[3-(2,3,4,5-tetrafluorophenyl)-1,2-oxazol-5-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 175024289) has the molecular formula C22H16F6N4O3 and a molecular weight of 498.38 g/mol. Its IUPAC name is (3R)-2-(2,4-difluorophenyl)-3-[[3-(2,3,4,5-tetrafluorophenyl)-1,2-oxazol-5-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (3R)-2-(2,4-difluorophenyl)-3-[[3-(2,3,4,5-tetrafluorophenyl)-1,2-oxazol-5-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 175024289 |
| Molecular Formula | C22H16F6N4O3 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (3R)-2-(2,4-difluorophenyl)-3-[[3-(2,3,4,5-tetrafluorophenyl)-1,2-oxazol-5-yl]methoxy]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](OCc1cc(-c2cc(F)c(F)c(F)c2F)no1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H16F6N4O3/c1-11(22(33,8-32-10-29-9-30-32)15-3-2-12(23)4-16(15)24)34-7-13-5-18(31-35-13)14-6-17(25)20(27)21(28)19(14)26/h2-6,9-11,33H,7-8H2,1H3/t11-,22?/m1/s1 |
| InChIKey | QZCGJRADQNVJHS-FAYKFVSFSA-N |
| XLogP | 4.26 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|