C16H24BrNO4S — CID 175024920
propyl 3-(4-bromophenyl)-2-(butylsulfonylamino)propanoate (PubChem CID 175024920) has the molecular formula C16H24BrNO4S and a molecular weight of 406.34 g/mol. Its IUPAC name is propyl 3-(4-bromophenyl)-2-(butylsulfonylamino)propanoate.
| Compound Name | propyl 3-(4-bromophenyl)-2-(butylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 175024920 |
| Molecular Formula | C16H24BrNO4S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | propyl 3-(4-bromophenyl)-2-(butylsulfonylamino)propanoate |
| SMILES | CCCCS(=O)(=O)NC(Cc1ccc(Br)cc1)C(=O)OCCC |
| InChI | InChI=1S/C16H24BrNO4S/c1-3-5-11-23(20,21)18-15(16(19)22-10-4-2)12-13-6-8-14(17)9-7-13/h6-9,15,18H,3-5,10-12H2,1-2H3 |
| InChIKey | ANNVZMOEFQJKDZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |