C31H42Cl2N2O3 — CID 175025408
[2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate (PubChem CID 175025408) has the molecular formula C31H42Cl2N2O3 and a molecular weight of 561.59 g/mol. Its IUPAC name is [2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate.
| Compound Name | [2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate |
|---|---|
| PubChem CID | 175025408 |
| Molecular Formula | C31H42Cl2N2O3 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methyl]-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate |
| SMILES | CCCCCCC(CC)C(=O)OC1C(Cc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)CC12CCNCC2 |
| InChI | InChI=1S/C31H42Cl2N2O3/c1-3-5-6-7-9-20(4-2)30(36)37-29-22(19-31(29)14-16-34-17-15-31)18-23-27(35-38-28(23)21-12-13-21)26-24(32)10-8-11-25(26)33/h8,10-11,20-22,29,34H,3-7,9,12-19H2,1-2H3 |
| InChIKey | IWTMWGZVDAYLFU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|