C11H25AlO — CID 175025691
dimethylalumanylium;2,2,3,4-tetramethylpentan-3-olate (PubChem CID 175025691) has the molecular formula C11H25AlO and a molecular weight of 200.30 g/mol. Its IUPAC name is dimethylalumanylium;2,2,3,4-tetramethylpentan-3-olate.
| Compound Name | dimethylalumanylium;2,2,3,4-tetramethylpentan-3-olate |
|---|---|
| PubChem CID | 175025691 |
| Molecular Formula | C11H25AlO |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | dimethylalumanylium;2,2,3,4-tetramethylpentan-3-olate |
| SMILES | CC(C)C(C)([O-])C(C)(C)C.C[Al+]C |
| InChI | InChI=1S/C9H19O.2CH3.Al/c1-7(2)9(6,10)8(3,4)5;;;/h7H,1-6H3;2*1H3;/q-1;;;+1 |
| InChIKey | QACVAPTWGBGAAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |