C25H28N4O2 — CID 175026516
[2-(4-cyanoanilino)-1-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate (PubChem CID 175026516) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-1-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate.
| Compound Name | [2-(4-cyanoanilino)-1-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate |
|---|---|
| PubChem CID | 175026516 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [2-(4-cyanoanilino)-1-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)nc(Nc1ccc(C#N)cc1)n2[C@H]1C[C@@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C25H28N4O2/c1-16-11-20(14-25(3,4)13-16)29-23-10-9-21(31-17(2)30)12-22(23)28-24(29)27-19-7-5-18(15-26)6-8-19/h5-10,12,16,20H,11,13-14H2,1-4H3,(H,27,28)/t16-,20+/m1/s1 |
| InChIKey | FPTBLHBDUBZWTN-UZLBHIALSA-N |
| XLogP | 5.96 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|