About methyl 2-methyldodecanoate;methyl tridecanoate
methyl 2-methyldodecanoate;methyl tridecanoate (PubChem CID 175026615) has the molecular formula C28H56O4
and a molecular weight of 456.75 g/mol. Its IUPAC name is methyl 2-methyldodecanoate;methyl tridecanoate.
Molecular Properties
| Compound Name | methyl 2-methyldodecanoate;methyl tridecanoate |
| PubChem CID | 175026615 |
| Molecular Formula | C28H56O4 |
| Molecular Weight | 456.75 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | methyl 2-methyldodecanoate;methyl tridecanoate |
| SMILES | CCCCCCCCCCC(C)C(=O)OC.CCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/2C14H28O2/c1-4-5-6-7-8-9-10-11-12-13(2)14(15)16-3;1-3-4-5-6-7-8-9-10-11-12-13-14(15)16-2/h13H,4-12H2,1-3H3;3-13H2,1-2H3 |
| InChIKey | NYNPYIHAWBPKIK-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.75 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyldodecanoate;methyl tridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyldodecanoate;methyl tridecanoate?
The IUPAC name of methyl 2-methyldodecanoate;methyl tridecanoate (CID 175026615) is methyl 2-methyldodecanoate;methyl tridecanoate.
What is the SMILES notation for methyl 2-methyldodecanoate;methyl tridecanoate?
The canonical SMILES for methyl 2-methyldodecanoate;methyl tridecanoate is CCCCCCCCCCC(C)C(=O)OC.CCCCCCCCCCCCC(=O)OC.
What is the InChIKey of methyl 2-methyldodecanoate;methyl tridecanoate?
The InChIKey is NYNPYIHAWBPKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H28O2/c1-4-5-6-7-8-9-10-11-12-13(2)14(15)16-3;1-3-4-5-6-7-8-9-10-11-12-13-14(15)16-2/h13H,4-12H2,1-3H3;3-13H2,1-2H3.
What are the key properties of methyl 2-methyldodecanoate;methyl tridecanoate?
methyl 2-methyldodecanoate;methyl tridecanoate has a molecular weight of 456.75 g/mol, XLogP of 8.80, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyldodecanoate;methyl tridecanoate is sourced from PubChem (CID 175026615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).