About (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate
(2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate (PubChem CID 175026630) has the molecular formula C8H3F3N2O5
and a molecular weight of 264.11 g/mol. Its IUPAC name is (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate.
Molecular Properties
| Compound Name | (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate |
| PubChem CID | 175026630 |
| Molecular Formula | C8H3F3N2O5 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate |
| SMILES | N#CCC(=O)OC(=O)C(C#N)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H3F3N2O5/c9-8(10,11)7(16)17-4(3-13)6(15)18-5(14)1-2-12/h4H,1H2 |
| InChIKey | CJZYXAOSHKCHKW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 117.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate?
The IUPAC name of (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate (CID 175026630) is (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate.
What is the SMILES notation for (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate?
The canonical SMILES for (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate is N#CCC(=O)OC(=O)C(C#N)OC(=O)C(F)(F)F.
What is the InChIKey of (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate?
The InChIKey is CJZYXAOSHKCHKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F3N2O5/c9-8(10,11)7(16)17-4(3-13)6(15)18-5(14)1-2-12/h4H,1H2.
What are the key properties of (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate?
(2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate has a molecular weight of 264.11 g/mol, XLogP of -0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanoacetyl) 2-cyano-2-(2,2,2-trifluoroacetyl)oxyacetate is sourced from PubChem (CID 175026630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).