About bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+)
bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) (PubChem CID 175026738) has the molecular formula C30H50O2Ti
and a molecular weight of 490.60 g/mol. Its IUPAC name is bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+).
Molecular Properties
| Compound Name | bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) |
| PubChem CID | 175026738 |
| Molecular Formula | C30H50O2Ti |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) |
| SMILES | CC(C)(C)OCCCCCCc1ccc[cH-]1.CC(C)(C)OCCCCCCc1ccc[cH-]1.[Ti+2] |
| InChI | InChI=1S/2C15H25O.Ti/c2*1-15(2,3)16-13-9-5-4-6-10-14-11-7-8-12-14;/h2*7-8,11-12H,4-6,9-10,13H2,1-3H3;/q2*-1;+2 |
| InChIKey | JZBRVQRCJYHTRD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+)?
The IUPAC name of bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) (CID 175026738) is bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+).
What is the SMILES notation for bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+)?
The canonical SMILES for bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) is CC(C)(C)OCCCCCCc1ccc[cH-]1.CC(C)(C)OCCCCCCc1ccc[cH-]1.[Ti+2].
What is the InChIKey of bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+)?
The InChIKey is JZBRVQRCJYHTRD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H25O.Ti/c2*1-15(2,3)16-13-9-5-4-6-10-14-11-7-8-12-14;/h2*7-8,11-12H,4-6,9-10,13H2,1-3H3;/q2*-1;+2.
What are the key properties of bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+)?
bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) has a molecular weight of 490.60 g/mol, XLogP of 8.64, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene);titanium(2+) is sourced from PubChem (CID 175026738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).