About 4-phenyldiazenylbenzene-1,2,3,5-tetramine
4-phenyldiazenylbenzene-1,2,3,5-tetramine (PubChem CID 175027546) has the molecular formula C12H14N6
and a molecular weight of 242.29 g/mol. Its IUPAC name is 4-phenyldiazenylbenzene-1,2,3,5-tetramine.
Molecular Properties
| Compound Name | 4-phenyldiazenylbenzene-1,2,3,5-tetramine |
| PubChem CID | 175027546 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-phenyldiazenylbenzene-1,2,3,5-tetramine |
| SMILES | Nc1cc(N)c(/N=N/c2ccccc2)c(N)c1N |
| InChI | InChI=1S/C12H14N6/c13-8-6-9(14)12(11(16)10(8)15)18-17-7-4-2-1-3-5-7/h1-6H,13-16H2/b18-17+ |
| InChIKey | OMSXJFYAYITCRY-ISLYRVAYSA-N |
| XLogP | 2.43 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenylbenzene-1,2,3,5-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenylbenzene-1,2,3,5-tetramine?
The IUPAC name of 4-phenyldiazenylbenzene-1,2,3,5-tetramine (CID 175027546) is 4-phenyldiazenylbenzene-1,2,3,5-tetramine.
What is the SMILES notation for 4-phenyldiazenylbenzene-1,2,3,5-tetramine?
The canonical SMILES for 4-phenyldiazenylbenzene-1,2,3,5-tetramine is Nc1cc(N)c(/N=N/c2ccccc2)c(N)c1N.
What is the InChIKey of 4-phenyldiazenylbenzene-1,2,3,5-tetramine?
The InChIKey is OMSXJFYAYITCRY-ISLYRVAYSA-N. The full InChI is InChI=1S/C12H14N6/c13-8-6-9(14)12(11(16)10(8)15)18-17-7-4-2-1-3-5-7/h1-6H,13-16H2/b18-17+.
What are the key properties of 4-phenyldiazenylbenzene-1,2,3,5-tetramine?
4-phenyldiazenylbenzene-1,2,3,5-tetramine has a molecular weight of 242.29 g/mol, XLogP of 2.43, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenylbenzene-1,2,3,5-tetramine is sourced from PubChem (CID 175027546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).