About 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine
2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine (PubChem CID 175028023) has the molecular formula C5F6O2
and a molecular weight of 206.04 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine.
Analyze 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine?
The IUPAC name of 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine (CID 175028023) is 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine.
What is the SMILES notation for 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine?
The canonical SMILES for 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine is FC(F)=C1OC(F)=C(F)C(F)(F)O1.
What is the InChIKey of 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine?
The InChIKey is QKEDMSDYONZNIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5F6O2/c6-1-3(9)12-4(2(7)8)13-5(1,10)11.
What are the key properties of 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine?
2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine has a molecular weight of 206.04 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethylidene)-4,4,5,6-tetrafluoro-1,3-dioxine is sourced from PubChem (CID 175028023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).