About N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine
N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine (PubChem CID 175028387) has the molecular formula C10H13N3Se
and a molecular weight of 254.20 g/mol. Its IUPAC name is N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine |
| PubChem CID | 175028387 |
| Molecular Formula | C10H13N3Se |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine |
| SMILES | CCNC1[Se]C=NN1c1ccccc1 |
| InChI | InChI=1S/C10H13N3Se/c1-2-11-10-13(12-8-14-10)9-6-4-3-5-7-9/h3-8,10-11H,2H2,1H3 |
| InChIKey | PBMFGXDWJGFTSK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine?
The IUPAC name of N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine (CID 175028387) is N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine.
What is the SMILES notation for N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine?
The canonical SMILES for N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine is CCNC1[Se]C=NN1c1ccccc1.
What is the InChIKey of N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine?
The InChIKey is PBMFGXDWJGFTSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3Se/c1-2-11-10-13(12-8-14-10)9-6-4-3-5-7-9/h3-8,10-11H,2H2,1H3.
What are the key properties of N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine?
N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine has a molecular weight of 254.20 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-phenyl-2H-1,3,4-selenadiazol-2-amine is sourced from PubChem (CID 175028387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).