About 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen
4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen (PubChem CID 175028589) has the molecular formula C21H18O4
and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen.
Molecular Properties
| Compound Name | 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen |
| PubChem CID | 175028589 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen |
| SMILES | O=C(O)c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1C(=O)O.[H][H].[H][H] |
| InChI | InChI=1S/C21H14O4.2H2/c22-20(23)17-9-8-13(11-19(17)21(24)25)15-6-3-7-16-14-5-2-1-4-12(14)10-18(15)16;;/h1-9,11H,10H2,(H,22,23)(H,24,25);2*1H |
| InChIKey | ALURUITVRGXLIO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen?
The IUPAC name of 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen (CID 175028589) is 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen.
What is the SMILES notation for 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen?
The canonical SMILES for 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen is O=C(O)c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1C(=O)O.[H][H].[H][H].
What is the InChIKey of 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen?
The InChIKey is ALURUITVRGXLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O4.2H2/c22-20(23)17-9-8-13(11-19(17)21(24)25)15-6-3-7-16-14-5-2-1-4-12(14)10-18(15)16;;/h1-9,11H,10H2,(H,22,23)(H,24,25);2*1H.
What are the key properties of 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen?
4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen has a molecular weight of 334.37 g/mol, XLogP of 4.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9H-fluoren-1-yl)phthalic acid;molecular hydrogen is sourced from PubChem (CID 175028589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).