About carbamoylurea;copper;thiourea
carbamoylurea;copper;thiourea (PubChem CID 175029091) has the molecular formula C3H9CuN5O2S
and a molecular weight of 242.75 g/mol. Its IUPAC name is carbamoylurea;copper;thiourea.
Molecular Properties
| Compound Name | carbamoylurea;copper;thiourea |
| PubChem CID | 175029091 |
| Molecular Formula | C3H9CuN5O2S |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | carbamoylurea;copper;thiourea |
| SMILES | NC(=O)NC(N)=O.NC(N)=S.[Cu] |
| InChI | InChI=1S/C2H5N3O2.CH4N2S.Cu/c3-1(6)5-2(4)7;2-1(3)4;/h(H5,3,4,5,6,7);(H4,2,3,4); |
| InChIKey | CLERRQBNHVHGSD-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze carbamoylurea;copper;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;copper;thiourea?
The IUPAC name of carbamoylurea;copper;thiourea (CID 175029091) is carbamoylurea;copper;thiourea.
What is the SMILES notation for carbamoylurea;copper;thiourea?
The canonical SMILES for carbamoylurea;copper;thiourea is NC(=O)NC(N)=O.NC(N)=S.[Cu].
What is the InChIKey of carbamoylurea;copper;thiourea?
The InChIKey is CLERRQBNHVHGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2.CH4N2S.Cu/c3-1(6)5-2(4)7;2-1(3)4;/h(H5,3,4,5,6,7);(H4,2,3,4);.
What are the key properties of carbamoylurea;copper;thiourea?
carbamoylurea;copper;thiourea has a molecular weight of 242.75 g/mol, XLogP of -2.08, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;copper;thiourea is sourced from PubChem (CID 175029091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).