C29H29BrN2O2 — CID 175029185
1,8-dimethoxy-N,N-dimethyl-9,10-diphenyl-9H-acridin-2-amine;hydrobromide (PubChem CID 175029185) has the molecular formula C29H29BrN2O2 and a molecular weight of 517.47 g/mol. Its IUPAC name is 1,8-dimethoxy-N,N-dimethyl-9,10-diphenyl-9H-acridin-2-amine;hydrobromide.
| Compound Name | 1,8-dimethoxy-N,N-dimethyl-9,10-diphenyl-9H-acridin-2-amine;hydrobromide |
|---|---|
| PubChem CID | 175029185 |
| Molecular Formula | C29H29BrN2O2 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1,8-dimethoxy-N,N-dimethyl-9,10-diphenyl-9H-acridin-2-amine;hydrobromide |
| SMILES | Br.COc1cccc2c1C(c1ccccc1)c1c(ccc(N(C)C)c1OC)N2c1ccccc1 |
| InChI | InChI=1S/C29H28N2O2.BrH/c1-30(2)24-19-18-23-28(29(24)33-4)26(20-12-7-5-8-13-20)27-22(16-11-17-25(27)32-3)31(23)21-14-9-6-10-15-21;/h5-19,26H,1-4H3;1H |
| InChIKey | UPQYREYHLSVDPT-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |