About (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine
(2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine (PubChem CID 175029329) has the molecular formula C20H18F7NO
and a molecular weight of 421.36 g/mol. Its IUPAC name is (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine |
| PubChem CID | 175029329 |
| Molecular Formula | C20H18F7NO |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine |
| SMILES | C=C[C@@](N)(COCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F7NO/c1-2-18(28,14-3-5-17(21)6-4-14)12-29-8-7-13-9-15(19(22,23)24)11-16(10-13)20(25,26)27/h2-6,9-11H,1,7-8,12,28H2/t18-/m1/s1 |
| InChIKey | SYGWOKLOILJVMV-GOSISDBHSA-N |
| XLogP | 5.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine?
The IUPAC name of (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine (CID 175029329) is (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine.
What is the SMILES notation for (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine?
The canonical SMILES for (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine is C=C[C@@](N)(COCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(F)cc1.
What is the InChIKey of (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine?
The InChIKey is SYGWOKLOILJVMV-GOSISDBHSA-N. The full InChI is InChI=1S/C20H18F7NO/c1-2-18(28,14-3-5-17(21)6-4-14)12-29-8-7-13-9-15(19(22,23)24)11-16(10-13)20(25,26)27/h2-6,9-11H,1,7-8,12,28H2/t18-/m1/s1.
What are the key properties of (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine?
(2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine has a molecular weight of 421.36 g/mol, XLogP of 5.46, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)but-3-en-2-amine is sourced from PubChem (CID 175029329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).