About CID 175029736
CID 175029736 (PubChem CID 175029736) has the molecular formula C20H21BN4
and a molecular weight of 328.23 g/mol.
Molecular Properties
| Compound Name | CID 175029736 |
| PubChem CID | 175029736 |
| Molecular Formula | C20H21BN4 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | — |
| SMILES | [B]c1[nH]cc2ccccc12.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1 |
| InChI | InChI=1S/C8H6BN.3C4H5N/c9-8-7-4-2-1-3-6(7)5-10-8;3*1-2-4-5-3-1/h1-5,10H;3*1-5H |
| InChIKey | MQNMWHVQZGLJRF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175029736 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175029736?
The IUPAC name of CID 175029736 (CID 175029736) is not available.
What is the SMILES notation for CID 175029736?
The canonical SMILES for CID 175029736 is [B]c1[nH]cc2ccccc12.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.
What is the InChIKey of CID 175029736?
The InChIKey is MQNMWHVQZGLJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BN.3C4H5N/c9-8-7-4-2-1-3-6(7)5-10-8;3*1-2-4-5-3-1/h1-5,10H;3*1-5H.
What are the key properties of CID 175029736?
CID 175029736 has a molecular weight of 328.23 g/mol, XLogP of 4.01, 0 rotatable bonds, 4 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175029736 is sourced from PubChem (CID 175029736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).