methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate

C7H9F3N2O3S — CID 175029819

IUPACmethyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate
SMILESCOS(=O)(=O)Cc1ccn(CC(F)(F)F)n1
InChIInChI=1S/C7H9F3N2O3S/c1-15-16(13,14)4-6-2-3-12(11-6)5-7(8,9)10/h2-3H,4-5H2,1H3
InChIKeyCGONSKUIRDJTOP-UHFFFAOYSA-N
MW258.22 g/mol
LogP0.92
Rot. Bonds4

About methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate

methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate (PubChem CID 175029819) has the molecular formula C7H9F3N2O3S and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate.

Molecular Properties

Compound Namemethyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate
PubChem CID175029819
Molecular FormulaC7H9F3N2O3S
Molecular Weight258.22 g/mol
Exact Mass258.03
IUPAC Namemethyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate
SMILESCOS(=O)(=O)Cc1ccn(CC(F)(F)F)n1
InChIInChI=1S/C7H9F3N2O3S/c1-15-16(13,14)4-6-2-3-12(11-6)5-7(8,9)10/h2-3H,4-5H2,1H3
InChIKeyCGONSKUIRDJTOP-UHFFFAOYSA-N
XLogP0.92
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.22
LogP ≤ 50.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate?
The IUPAC name of methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate (CID 175029819) is methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate.
What is the SMILES notation for methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate?
The canonical SMILES for methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate is COS(=O)(=O)Cc1ccn(CC(F)(F)F)n1.
What is the InChIKey of methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate?
The InChIKey is CGONSKUIRDJTOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O3S/c1-15-16(13,14)4-6-2-3-12(11-6)5-7(8,9)10/h2-3H,4-5H2,1H3.
What are the key properties of methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate?
methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate has a molecular weight of 258.22 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate is sourced from PubChem (CID 175029819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).