C7H9F3N2O3S — CID 175029819
methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate (PubChem CID 175029819) has the molecular formula C7H9F3N2O3S and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate.
| Compound Name | methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 175029819 |
| Molecular Formula | C7H9F3N2O3S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | methyl [1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanesulfonate |
| SMILES | COS(=O)(=O)Cc1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C7H9F3N2O3S/c1-15-16(13,14)4-6-2-3-12(11-6)5-7(8,9)10/h2-3H,4-5H2,1H3 |
| InChIKey | CGONSKUIRDJTOP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|