About benzene;N,2-diphenylaniline
benzene;N,2-diphenylaniline (PubChem CID 175029921) has the molecular formula C24H21N
and a molecular weight of 323.44 g/mol. Its IUPAC name is benzene;N,2-diphenylaniline.
Molecular Properties
| Compound Name | benzene;N,2-diphenylaniline |
| PubChem CID | 175029921 |
| Molecular Formula | C24H21N |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | benzene;N,2-diphenylaniline |
| SMILES | c1ccc(Nc2ccccc2-c2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C18H15N.C6H6/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)19-16-11-5-2-6-12-16;1-2-4-6-5-3-1/h1-14,19H;1-6H |
| InChIKey | DUKDTKHZYQEMDB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;N,2-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N,2-diphenylaniline?
The IUPAC name of benzene;N,2-diphenylaniline (CID 175029921) is benzene;N,2-diphenylaniline.
What is the SMILES notation for benzene;N,2-diphenylaniline?
The canonical SMILES for benzene;N,2-diphenylaniline is c1ccc(Nc2ccccc2-c2ccccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;N,2-diphenylaniline?
The InChIKey is DUKDTKHZYQEMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C6H6/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)19-16-11-5-2-6-12-16;1-2-4-6-5-3-1/h1-14,19H;1-6H.
What are the key properties of benzene;N,2-diphenylaniline?
benzene;N,2-diphenylaniline has a molecular weight of 323.44 g/mol, XLogP of 6.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N,2-diphenylaniline is sourced from PubChem (CID 175029921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).