About 4-bromothieno[2,3-c]thiophene-6-carbaldehyde
4-bromothieno[2,3-c]thiophene-6-carbaldehyde (PubChem CID 175029996) has the molecular formula C7H3BrOS2
and a molecular weight of 247.14 g/mol. Its IUPAC name is 4-bromothieno[2,3-c]thiophene-6-carbaldehyde.
Molecular Properties
| Compound Name | 4-bromothieno[2,3-c]thiophene-6-carbaldehyde |
| PubChem CID | 175029996 |
| Molecular Formula | C7H3BrOS2 |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 245.88 |
| IUPAC Name | 4-bromothieno[2,3-c]thiophene-6-carbaldehyde |
| SMILES | O=Cc1sc(Br)c2ccsc12 |
| InChI | InChI=1S/C7H3BrOS2/c8-7-4-1-2-10-6(4)5(3-9)11-7/h1-3H |
| InChIKey | QZMRDKNYIVZBSO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromothieno[2,3-c]thiophene-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromothieno[2,3-c]thiophene-6-carbaldehyde?
The IUPAC name of 4-bromothieno[2,3-c]thiophene-6-carbaldehyde (CID 175029996) is 4-bromothieno[2,3-c]thiophene-6-carbaldehyde.
What is the SMILES notation for 4-bromothieno[2,3-c]thiophene-6-carbaldehyde?
The canonical SMILES for 4-bromothieno[2,3-c]thiophene-6-carbaldehyde is O=Cc1sc(Br)c2ccsc12.
What is the InChIKey of 4-bromothieno[2,3-c]thiophene-6-carbaldehyde?
The InChIKey is QZMRDKNYIVZBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrOS2/c8-7-4-1-2-10-6(4)5(3-9)11-7/h1-3H.
What are the key properties of 4-bromothieno[2,3-c]thiophene-6-carbaldehyde?
4-bromothieno[2,3-c]thiophene-6-carbaldehyde has a molecular weight of 247.14 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromothieno[2,3-c]thiophene-6-carbaldehyde is sourced from PubChem (CID 175029996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).