About 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene
6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene (PubChem CID 175030316) has the molecular formula C9H12FN3O
and a molecular weight of 197.21 g/mol. Its IUPAC name is 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene.
Molecular Properties
| Compound Name | 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene |
| PubChem CID | 175030316 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene |
| SMILES | FC1=CCCC1.Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C5H7F.C4H5N3O/c6-5-3-1-2-4-5;5-3-1-2-6-4(8)7-3/h3H,1-2,4H2;1-2H,(H3,5,6,7,8) |
| InChIKey | JSZKPBOVVDDPAA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene?
The IUPAC name of 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene (CID 175030316) is 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene.
What is the SMILES notation for 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene?
The canonical SMILES for 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene is FC1=CCCC1.Nc1ccnc(=O)[nH]1.
What is the InChIKey of 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene?
The InChIKey is JSZKPBOVVDDPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F.C4H5N3O/c6-5-3-1-2-4-5;5-3-1-2-6-4(8)7-3/h3H,1-2,4H2;1-2H,(H3,5,6,7,8).
What are the key properties of 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene?
6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene has a molecular weight of 197.21 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrimidin-2-one;1-fluorocyclopentene is sourced from PubChem (CID 175030316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).