C8H7F3N4O4S — CID 175030318
(6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonylamino) 2,2,2-trifluoroacetate (PubChem CID 175030318) has the molecular formula C8H7F3N4O4S and a molecular weight of 312.23 g/mol. Its IUPAC name is (6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonylamino) 2,2,2-trifluoroacetate.
| Compound Name | (6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonylamino) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175030318 |
| Molecular Formula | C8H7F3N4O4S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | (6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonylamino) 2,2,2-trifluoroacetate |
| SMILES | O=C(ONS(=O)(=O)c1ncc2c(n1)CNC2)C(F)(F)F |
| InChI | InChI=1S/C8H7F3N4O4S/c9-8(10,11)6(16)19-15-20(17,18)7-13-2-4-1-12-3-5(4)14-7/h2,12,15H,1,3H2 |
| InChIKey | KQEFMJYBDXEWRA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|