About 4-bromo-1H-inden-1-ide;zirconium
4-bromo-1H-inden-1-ide;zirconium (PubChem CID 175030848) has the molecular formula C9H6BrZr-
and a molecular weight of 285.28 g/mol. Its IUPAC name is 4-bromo-1H-inden-1-ide;zirconium.
Molecular Properties
| Compound Name | 4-bromo-1H-inden-1-ide;zirconium |
| PubChem CID | 175030848 |
| Molecular Formula | C9H6BrZr- |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 282.87 |
| IUPAC Name | 4-bromo-1H-inden-1-ide;zirconium |
| SMILES | Brc1cccc2[cH-]ccc12.[Zr] |
| InChI | InChI=1S/C9H6Br.Zr/c10-9-6-2-4-7-3-1-5-8(7)9;/h1-6H;/q-1; |
| InChIKey | ZWVGKCOFLOSPIM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1H-inden-1-ide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-inden-1-ide;zirconium?
The IUPAC name of 4-bromo-1H-inden-1-ide;zirconium (CID 175030848) is 4-bromo-1H-inden-1-ide;zirconium.
What is the SMILES notation for 4-bromo-1H-inden-1-ide;zirconium?
The canonical SMILES for 4-bromo-1H-inden-1-ide;zirconium is Brc1cccc2[cH-]ccc12.[Zr].
What is the InChIKey of 4-bromo-1H-inden-1-ide;zirconium?
The InChIKey is ZWVGKCOFLOSPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br.Zr/c10-9-6-2-4-7-3-1-5-8(7)9;/h1-6H;/q-1;.
What are the key properties of 4-bromo-1H-inden-1-ide;zirconium?
4-bromo-1H-inden-1-ide;zirconium has a molecular weight of 285.28 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-inden-1-ide;zirconium is sourced from PubChem (CID 175030848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).