About tert-butyl acetate;1H-imidazole
tert-butyl acetate;1H-imidazole (PubChem CID 175030975) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is tert-butyl acetate;1H-imidazole.
Molecular Properties
| Compound Name | tert-butyl acetate;1H-imidazole |
| PubChem CID | 175030975 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | tert-butyl acetate;1H-imidazole |
| SMILES | CC(=O)OC(C)(C)C.c1c[nH]cn1 |
| InChI | InChI=1S/C6H12O2.C3H4N2/c1-5(7)8-6(2,3)4;1-2-5-3-4-1/h1-4H3;1-3H,(H,4,5) |
| InChIKey | CLZFIFYDILYCGB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl acetate;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;1H-imidazole?
The IUPAC name of tert-butyl acetate;1H-imidazole (CID 175030975) is tert-butyl acetate;1H-imidazole.
What is the SMILES notation for tert-butyl acetate;1H-imidazole?
The canonical SMILES for tert-butyl acetate;1H-imidazole is CC(=O)OC(C)(C)C.c1c[nH]cn1.
What is the InChIKey of tert-butyl acetate;1H-imidazole?
The InChIKey is CLZFIFYDILYCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H4N2/c1-5(7)8-6(2,3)4;1-2-5-3-4-1/h1-4H3;1-3H,(H,4,5).
What are the key properties of tert-butyl acetate;1H-imidazole?
tert-butyl acetate;1H-imidazole has a molecular weight of 184.24 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;1H-imidazole is sourced from PubChem (CID 175030975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).