About bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate
bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate (PubChem CID 175031183) has the molecular formula C25H16O4S8
and a molecular weight of 636.94 g/mol. Its IUPAC name is bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate |
| PubChem CID | 175031183 |
| Molecular Formula | C25H16O4S8 |
| Molecular Weight | 636.94 g/mol |
| Exact Mass | 635.88 |
| IUPAC Name | bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OSc2cccs2)cc(Sc2cccs2)c(C(=O)OSc2cccs2)c1Sc1cccs1 |
| InChI | InChI=1S/C25H16O4S8/c1-15-16(24(26)28-36-20-8-4-12-32-20)14-17(34-18-6-2-10-30-18)22(23(15)35-19-7-3-11-31-19)25(27)29-37-21-9-5-13-33-21/h2-14H,1H3 |
| InChIKey | CMRBRJSZNBGIQZ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 636.94 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate?
The IUPAC name of bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate (CID 175031183) is bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate.
What is the SMILES notation for bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate?
The canonical SMILES for bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate is Cc1c(C(=O)OSc2cccs2)cc(Sc2cccs2)c(C(=O)OSc2cccs2)c1Sc1cccs1.
What is the InChIKey of bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate?
The InChIKey is CMRBRJSZNBGIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16O4S8/c1-15-16(24(26)28-36-20-8-4-12-32-20)14-17(34-18-6-2-10-30-18)22(23(15)35-19-7-3-11-31-19)25(27)29-37-21-9-5-13-33-21/h2-14H,1H3.
What are the key properties of bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate?
bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate has a molecular weight of 636.94 g/mol, XLogP of 10.27, 10 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(thiophen-2-ylsulfanyl) 2-methyl-3,5-bis(thiophen-2-ylsulfanyl)benzene-1,4-dicarboxylate is sourced from PubChem (CID 175031183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).