C43H38F2N6O3 — CID 175031448
4-[2-[6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzimidazol-1-yl]ethyl]morpholine;3-(3-fluoro-4-nitrophenyl)-2-(3-methylphenyl)pyridine (PubChem CID 175031448) has the molecular formula C43H38F2N6O3 and a molecular weight of 724.81 g/mol. Its IUPAC name is 4-[2-[6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzimidazol-1-yl]ethyl]morpholine;3-(3-fluoro-4-nitrophenyl)-2-(3-methylphenyl)pyridine.
| Compound Name | 4-[2-[6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzimidazol-1-yl]ethyl]morpholine;3-(3-fluoro-4-nitrophenyl)-2-(3-methylphenyl)pyridine |
|---|---|
| PubChem CID | 175031448 |
| Molecular Formula | C43H38F2N6O3 |
| Molecular Weight | 724.81 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | 4-[2-[6-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]benzimidazol-1-yl]ethyl]morpholine;3-(3-fluoro-4-nitrophenyl)-2-(3-methylphenyl)pyridine |
| SMILES | Cc1cc(-c2ncccc2-c2ccc3ncn(CCN4CCOCC4)c3c2)ccc1F.Cc1cccc(-c2ncccc2-c2ccc([N+](=O)[O-])c(F)c2)c1 |
| InChI | InChI=1S/C25H25FN4O.C18H13FN2O2/c1-18-15-20(4-6-22(18)26)25-21(3-2-8-27-25)19-5-7-23-24(16-19)30(17-28-23)10-9-29-11-13-31-14-12-29;1-12-4-2-5-14(10-12)18-15(6-3-9-20-18)13-7-8-17(21(22)23)16(19)11-13/h2-8,15-17H,9-14H2,1H3;2-11H,1H3 |
| InChIKey | KOFHNZRVXYXYBI-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.81 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|