About 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid
1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid (PubChem CID 175031750) has the molecular formula C18H33NS
and a molecular weight of 295.54 g/mol. Its IUPAC name is 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid.
Molecular Properties
| Compound Name | 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid |
| PubChem CID | 175031750 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid |
| SMILES | CC1CCCCC1(C)C(C)(C)C1CCCCC1.N=C=S |
| InChI | InChI=1S/C17H32.CHNS/c1-14-10-8-9-13-17(14,4)16(2,3)15-11-6-5-7-12-15;2-1-3/h14-15H,5-13H2,1-4H3;2H |
| InChIKey | ZVZYOWNVOKXXJG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid?
The IUPAC name of 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid (CID 175031750) is 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid.
What is the SMILES notation for 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid?
The canonical SMILES for 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid is CC1CCCCC1(C)C(C)(C)C1CCCCC1.N=C=S.
What is the InChIKey of 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid?
The InChIKey is ZVZYOWNVOKXXJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32.CHNS/c1-14-10-8-9-13-17(14,4)16(2,3)15-11-6-5-7-12-15;2-1-3/h14-15H,5-13H2,1-4H3;2H.
What are the key properties of 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid?
1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid has a molecular weight of 295.54 g/mol, XLogP of 6.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylpropan-2-yl)-1,2-dimethylcyclohexane;isothiocyanic acid is sourced from PubChem (CID 175031750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).