About ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one
ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one (PubChem CID 175032099) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one |
| PubChem CID | 175032099 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one |
| SMILES | O=C1CCCC1CO.OCCO |
| InChI | InChI=1S/C6H10O2.C2H6O2/c7-4-5-2-1-3-6(5)8;3-1-2-4/h5,7H,1-4H2;3-4H,1-2H2 |
| InChIKey | IHDIYUYLXCSQHA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one?
The IUPAC name of ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one (CID 175032099) is ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one.
What is the SMILES notation for ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one?
The canonical SMILES for ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one is O=C1CCCC1CO.OCCO.
What is the InChIKey of ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one?
The InChIKey is IHDIYUYLXCSQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H6O2/c7-4-5-2-1-3-6(5)8;3-1-2-4/h5,7H,1-4H2;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one?
ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one has a molecular weight of 176.21 g/mol, XLogP of -0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-(hydroxymethyl)cyclopentan-1-one is sourced from PubChem (CID 175032099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).