C17H26NO5P — CID 175033011
(1S)-1-benzyl-1-methoxy-3,4,5,6,7,8-hexahydro-2H-isoquinoline;phosphoric acid (PubChem CID 175033011) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is (1S)-1-benzyl-1-methoxy-3,4,5,6,7,8-hexahydro-2H-isoquinoline;phosphoric acid.
| Compound Name | (1S)-1-benzyl-1-methoxy-3,4,5,6,7,8-hexahydro-2H-isoquinoline;phosphoric acid |
|---|---|
| PubChem CID | 175033011 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (1S)-1-benzyl-1-methoxy-3,4,5,6,7,8-hexahydro-2H-isoquinoline;phosphoric acid |
| SMILES | CO[C@]1(Cc2ccccc2)NCCC2=C1CCCC2.O=P(O)(O)O |
| InChI | InChI=1S/C17H23NO.H3O4P/c1-19-17(13-14-7-3-2-4-8-14)16-10-6-5-9-15(16)11-12-18-17;1-5(2,3)4/h2-4,7-8,18H,5-6,9-13H2,1H3;(H3,1,2,3,4)/t17-;/m0./s1 |
| InChIKey | ODMGPGGPZCLIKH-LMOVPXPDSA-N |
| XLogP | 2.51 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|