C11H15F3N6O4S — CID 175033141
1-(6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonyl)-1,2-dimethylguanidine;2,2,2-trifluoroacetic acid (PubChem CID 175033141) has the molecular formula C11H15F3N6O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonyl)-1,2-dimethylguanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonyl)-1,2-dimethylguanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175033141 |
| Molecular Formula | C11H15F3N6O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-ylsulfonyl)-1,2-dimethylguanidine;2,2,2-trifluoroacetic acid |
| SMILES | C/N=C(\N)N(C)S(=O)(=O)c1ncc2c(n1)CNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H14N6O2S.C2HF3O2/c1-11-8(10)15(2)18(16,17)9-13-4-6-3-12-5-7(6)14-9;3-2(4,5)1(6)7/h4,12H,3,5H2,1-2H3,(H2,10,11);(H,6,7) |
| InChIKey | CYWKRDAGTAWHAQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|