C24H22O5 — CID 175033274
1-hexoxypyrene-4,5-dicarboxylic acid (PubChem CID 175033274) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-hexoxypyrene-4,5-dicarboxylic acid.
| Compound Name | 1-hexoxypyrene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 175033274 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-hexoxypyrene-4,5-dicarboxylic acid |
| SMILES | CCCCCCOc1ccc2c(C(=O)O)c(C(=O)O)c3cccc4ccc1c2c43 |
| InChI | InChI=1S/C24H22O5/c1-2-3-4-5-13-29-18-12-11-17-20-15(18)10-9-14-7-6-8-16(19(14)20)21(23(25)26)22(17)24(27)28/h6-12H,2-5,13H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | WZSSPAPIBASGRO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|