About dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol
dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol (PubChem CID 175033393) has the molecular formula C7H11O3PS2
and a molecular weight of 238.27 g/mol. Its IUPAC name is dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol.
Molecular Properties
| Compound Name | dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol |
| PubChem CID | 175033393 |
| Molecular Formula | C7H11O3PS2 |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol |
| SMILES | Cc1ccccc1O.OP(O)(=S)S |
| InChI | InChI=1S/C7H8O.H3O2PS2/c1-6-4-2-3-5-7(6)8;1-3(2,4)5/h2-5,8H,1H3;(H3,1,2,4,5) |
| InChIKey | YZXDWCKOQBNVGW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol?
The IUPAC name of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol (CID 175033393) is dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol.
What is the SMILES notation for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol?
The canonical SMILES for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol is Cc1ccccc1O.OP(O)(=S)S.
What is the InChIKey of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol?
The InChIKey is YZXDWCKOQBNVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.H3O2PS2/c1-6-4-2-3-5-7(6)8;1-3(2,4)5/h2-5,8H,1H3;(H3,1,2,4,5).
What are the key properties of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol?
dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol has a molecular weight of 238.27 g/mol, XLogP of 1.83, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;2-methylphenol is sourced from PubChem (CID 175033393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).