C9H18O6S — CID 175033568
ethyl [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanesulfonate (PubChem CID 175033568) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is ethyl [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanesulfonate.
| Compound Name | ethyl [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanesulfonate |
|---|---|
| PubChem CID | 175033568 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethyl [(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanesulfonate |
| SMILES | CCOS(=O)(=O)C[C@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C9H18O6S/c1-4-13-16(11,12)6-8-7(5-10)14-9(2,3)15-8/h7-8,10H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | WMRLUISGCLZVKN-JGVFFNPUSA-N |
| XLogP | -0.13 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|